C28H26IN5O3 — CID 4657815
2-iodo-N-[2-oxo-2-[2-[[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylidene]hydrazinyl]ethyl]benzamide (PubChem CID 4657815) has the molecular formula C28H26IN5O3 and a molecular weight of 607.45 g/mol. Its IUPAC name is 2-iodo-N-[2-oxo-2-[2-[[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylidene]hydrazinyl]ethyl]benzamide.
| Compound Name | 2-iodo-N-[2-oxo-2-[2-[[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylidene]hydrazinyl]ethyl]benzamide |
|---|---|
| PubChem CID | 4657815 |
| Molecular Formula | C28H26IN5O3 |
| Molecular Weight | 607.45 g/mol |
| Exact Mass | 607.11 |
| IUPAC Name | 2-iodo-N-[2-oxo-2-[2-[[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylidene]hydrazinyl]ethyl]benzamide |
| SMILES | CCCOc1ccc(-c2nn(-c3ccccc3)cc2C=NNC(=O)CNC(=O)c2ccccc2I)cc1 |
| InChI | InChI=1S/C28H26IN5O3/c1-2-16-37-23-14-12-20(13-15-23)27-21(19-34(33-27)22-8-4-3-5-9-22)17-31-32-26(35)18-30-28(36)24-10-6-7-11-25(24)29/h3-15,17,19H,2,16,18H2,1H3,(H,30,36)(H,32,35) |
| InChIKey | FHRLPZJMHSFZJU-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|