C30H23IN4O2 — CID 3264542
2-iodo-N-[[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]methylideneamino]benzamide (PubChem CID 3264542) has the molecular formula C30H23IN4O2 and a molecular weight of 598.44 g/mol. Its IUPAC name is 2-iodo-N-[[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]methylideneamino]benzamide.
| Compound Name | 2-iodo-N-[[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 3264542 |
| Molecular Formula | C30H23IN4O2 |
| Molecular Weight | 598.44 g/mol |
| Exact Mass | 598.09 |
| IUPAC Name | 2-iodo-N-[[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]methylideneamino]benzamide |
| SMILES | O=C(NN=Cc1cn(-c2ccccc2)nc1-c1ccc(OCc2ccccc2)cc1)c1ccccc1I |
| InChI | InChI=1S/C30H23IN4O2/c31-28-14-8-7-13-27(28)30(36)33-32-19-24-20-35(25-11-5-2-6-12-25)34-29(24)23-15-17-26(18-16-23)37-21-22-9-3-1-4-10-22/h1-20H,21H2,(H,33,36) |
| InChIKey | TTXABSVSYCIFOX-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.44 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|