C38H29BrN6O4 — CID 3446758
N-[2-[(4-bromophenyl)carbamoyl]phenyl]-N'-[[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]methylideneamino]oxamide (PubChem CID 3446758) has the molecular formula C38H29BrN6O4 and a molecular weight of 713.59 g/mol. Its IUPAC name is N-[2-[(4-bromophenyl)carbamoyl]phenyl]-N'-[[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]methylideneamino]oxamide.
| Compound Name | N-[2-[(4-bromophenyl)carbamoyl]phenyl]-N'-[[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 3446758 |
| Molecular Formula | C38H29BrN6O4 |
| Molecular Weight | 713.59 g/mol |
| Exact Mass | 712.14 |
| IUPAC Name | N-[2-[(4-bromophenyl)carbamoyl]phenyl]-N'-[[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]methylideneamino]oxamide |
| SMILES | O=C(NN=Cc1cn(-c2ccccc2)nc1-c1ccc(OCc2ccccc2)cc1)C(=O)Nc1ccccc1C(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C38H29BrN6O4/c39-29-17-19-30(20-18-29)41-36(46)33-13-7-8-14-34(33)42-37(47)38(48)43-40-23-28-24-45(31-11-5-2-6-12-31)44-35(28)27-15-21-32(22-16-27)49-25-26-9-3-1-4-10-26/h1-24H,25H2,(H,41,46)(H,42,47)(H,43,48) |
| InChIKey | ZJWCNSQANLEJAC-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 126.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.59 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|