C34H36N6O4 — CID 5052859
N-[2-(cyclohexylcarbamoyl)phenyl]-N'-[[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylideneamino]oxamide (PubChem CID 5052859) has the molecular formula C34H36N6O4 and a molecular weight of 592.70 g/mol. Its IUPAC name is N-[2-(cyclohexylcarbamoyl)phenyl]-N'-[[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylideneamino]oxamide.
| Compound Name | N-[2-(cyclohexylcarbamoyl)phenyl]-N'-[[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 5052859 |
| Molecular Formula | C34H36N6O4 |
| Molecular Weight | 592.70 g/mol |
| Exact Mass | 592.28 |
| IUPAC Name | N-[2-(cyclohexylcarbamoyl)phenyl]-N'-[[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylideneamino]oxamide |
| SMILES | CCCOc1ccc(-c2nn(-c3ccccc3)cc2C=NNC(=O)C(=O)Nc2ccccc2C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C34H36N6O4/c1-2-21-44-28-19-17-24(18-20-28)31-25(23-40(39-31)27-13-7-4-8-14-27)22-35-38-34(43)33(42)37-30-16-10-9-15-29(30)32(41)36-26-11-5-3-6-12-26/h4,7-10,13-20,22-23,26H,2-3,5-6,11-12,21H2,1H3,(H,36,41)(H,37,42)(H,38,43) |
| InChIKey | CHQCRILYLXDBGS-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 126.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.70 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|