C28H27N5O3 — CID 6028564
N-(2-methylphenyl)-N'-[(Z)-[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylideneamino]oxamide (PubChem CID 6028564) has the molecular formula C28H27N5O3 and a molecular weight of 481.56 g/mol. Its IUPAC name is N-(2-methylphenyl)-N'-[(Z)-[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylideneamino]oxamide.
| Compound Name | N-(2-methylphenyl)-N'-[(Z)-[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 6028564 |
| Molecular Formula | C28H27N5O3 |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | N-(2-methylphenyl)-N'-[(Z)-[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylideneamino]oxamide |
| SMILES | CCCOc1ccc(-c2nn(-c3ccccc3)cc2/C=N\NC(=O)C(=O)Nc2ccccc2C)cc1 |
| InChI | InChI=1S/C28H27N5O3/c1-3-17-36-24-15-13-21(14-16-24)26-22(19-33(32-26)23-10-5-4-6-11-23)18-29-31-28(35)27(34)30-25-12-8-7-9-20(25)2/h4-16,18-19H,3,17H2,1-2H3,(H,30,34)(H,31,35)/b29-18- |
| InChIKey | UTGRAFGEXCHKQT-MIXAMLLLSA-N |
| XLogP | 4.73 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|