C39H32N6O4 — CID 3437930
N-[2-[(4-methylphenyl)carbamoyl]phenyl]-N'-[[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]methylideneamino]oxamide (PubChem CID 3437930) has the molecular formula C39H32N6O4 and a molecular weight of 648.72 g/mol. Its IUPAC name is N-[2-[(4-methylphenyl)carbamoyl]phenyl]-N'-[[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]methylideneamino]oxamide.
| Compound Name | N-[2-[(4-methylphenyl)carbamoyl]phenyl]-N'-[[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 3437930 |
| Molecular Formula | C39H32N6O4 |
| Molecular Weight | 648.72 g/mol |
| Exact Mass | 648.25 |
| IUPAC Name | N-[2-[(4-methylphenyl)carbamoyl]phenyl]-N'-[[1-phenyl-3-(4-phenylmethoxyphenyl)pyrazol-4-yl]methylideneamino]oxamide |
| SMILES | Cc1ccc(NC(=O)c2ccccc2NC(=O)C(=O)NN=Cc2cn(-c3ccccc3)nc2-c2ccc(OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C39H32N6O4/c1-27-16-20-31(21-17-27)41-37(46)34-14-8-9-15-35(34)42-38(47)39(48)43-40-24-30-25-45(32-12-6-3-7-13-32)44-36(30)29-18-22-33(23-19-29)49-26-28-10-4-2-5-11-28/h2-25H,26H2,1H3,(H,41,46)(H,42,47)(H,43,48) |
| InChIKey | UOWGPWIDIOOMMF-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 126.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.72 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|