C34H32N4O3 — CID 45055061
4-[(4-methylphenyl)methoxy]-N-[(E)-[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylideneamino]benzamide (PubChem CID 45055061) has the molecular formula C34H32N4O3 and a molecular weight of 544.66 g/mol. Its IUPAC name is 4-[(4-methylphenyl)methoxy]-N-[(E)-[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylideneamino]benzamide.
| Compound Name | 4-[(4-methylphenyl)methoxy]-N-[(E)-[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 45055061 |
| Molecular Formula | C34H32N4O3 |
| Molecular Weight | 544.66 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | 4-[(4-methylphenyl)methoxy]-N-[(E)-[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylideneamino]benzamide |
| SMILES | CCCOc1ccc(-c2nn(-c3ccccc3)cc2/C=N/NC(=O)c2ccc(OCc3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C34H32N4O3/c1-3-21-40-31-17-13-27(14-18-31)33-29(23-38(37-33)30-7-5-4-6-8-30)22-35-36-34(39)28-15-19-32(20-16-28)41-24-26-11-9-25(2)10-12-26/h4-20,22-23H,3,21,24H2,1-2H3,(H,36,39)/b35-22+ |
| InChIKey | XQLOTRSMXJLBLE-FADJLKOXSA-N |
| XLogP | 6.98 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.66 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|