C32H29N5O4S — CID 5056805
4-(benzenesulfonamido)-N-[[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylideneamino]benzamide (PubChem CID 5056805) has the molecular formula C32H29N5O4S and a molecular weight of 579.68 g/mol. Its IUPAC name is 4-(benzenesulfonamido)-N-[[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylideneamino]benzamide.
| Compound Name | 4-(benzenesulfonamido)-N-[[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 5056805 |
| Molecular Formula | C32H29N5O4S |
| Molecular Weight | 579.68 g/mol |
| Exact Mass | 579.19 |
| IUPAC Name | 4-(benzenesulfonamido)-N-[[1-phenyl-3-(4-propoxyphenyl)pyrazol-4-yl]methylideneamino]benzamide |
| SMILES | CCCOc1ccc(-c2nn(-c3ccccc3)cc2C=NNC(=O)c2ccc(NS(=O)(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C32H29N5O4S/c1-2-21-41-29-19-15-24(16-20-29)31-26(23-37(35-31)28-9-5-3-6-10-28)22-33-34-32(38)25-13-17-27(18-14-25)36-42(39,40)30-11-7-4-8-12-30/h3-20,22-23,36H,2,21H2,1H3,(H,34,38) |
| InChIKey | KMQIFVACKLPDMB-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.68 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|