C29H21BrClN5O3S — CID 124587265
N-[(Z)-[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-4-[(4-chlorophenyl)sulfonylamino]benzamide (PubChem CID 124587265) has the molecular formula C29H21BrClN5O3S and a molecular weight of 634.94 g/mol. Its IUPAC name is N-[(Z)-[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-4-[(4-chlorophenyl)sulfonylamino]benzamide.
| Compound Name | N-[(Z)-[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-4-[(4-chlorophenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 124587265 |
| Molecular Formula | C29H21BrClN5O3S |
| Molecular Weight | 634.94 g/mol |
| Exact Mass | 633.02 |
| IUPAC Name | N-[(Z)-[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-4-[(4-chlorophenyl)sulfonylamino]benzamide |
| SMILES | O=C(N/N=C\c1cn(-c2ccccc2)nc1-c1ccc(Br)cc1)c1ccc(NS(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C29H21BrClN5O3S/c30-23-10-6-20(7-11-23)28-22(19-36(34-28)26-4-2-1-3-5-26)18-32-33-29(37)21-8-14-25(15-9-21)35-40(38,39)27-16-12-24(31)13-17-27/h1-19,35H,(H,33,37)/b32-18- |
| InChIKey | UQDVWHSEGYSXSW-CAQPMQTCSA-N |
| XLogP | 6.52 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.94 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|