C24H17Br2N5O2 — CID 6014809
N-(4-bromophenyl)-N'-[(Z)-[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]methylideneamino]oxamide (PubChem CID 6014809) has the molecular formula C24H17Br2N5O2 and a molecular weight of 567.24 g/mol. Its IUPAC name is N-(4-bromophenyl)-N'-[(Z)-[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]methylideneamino]oxamide.
| Compound Name | N-(4-bromophenyl)-N'-[(Z)-[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 6014809 |
| Molecular Formula | C24H17Br2N5O2 |
| Molecular Weight | 567.24 g/mol |
| Exact Mass | 564.97 |
| IUPAC Name | N-(4-bromophenyl)-N'-[(Z)-[3-(4-bromophenyl)-1-phenylpyrazol-4-yl]methylideneamino]oxamide |
| SMILES | O=C(N/N=C\c1cn(-c2ccccc2)nc1-c1ccc(Br)cc1)C(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C24H17Br2N5O2/c25-18-8-6-16(7-9-18)22-17(15-31(30-22)21-4-2-1-3-5-21)14-27-29-24(33)23(32)28-20-12-10-19(26)11-13-20/h1-15H,(H,28,32)(H,29,33)/b27-14- |
| InChIKey | WQIZMTUWPJLNCL-VYYCAZPPSA-N |
| XLogP | 5.15 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.24 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|