C24H18ClN5O2 — CID 51061323
N-(2-chlorophenyl)-N'-[(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]oxamide (PubChem CID 51061323) has the molecular formula C24H18ClN5O2 and a molecular weight of 443.89 g/mol. Its IUPAC name is N-(2-chlorophenyl)-N'-[(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]oxamide.
| Compound Name | N-(2-chlorophenyl)-N'-[(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 51061323 |
| Molecular Formula | C24H18ClN5O2 |
| Molecular Weight | 443.89 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | N-(2-chlorophenyl)-N'-[(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]oxamide |
| SMILES | O=C(N/N=C/c1cn(-c2ccccc2)nc1-c1ccccc1)C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C24H18ClN5O2/c25-20-13-7-8-14-21(20)27-23(31)24(32)28-26-15-18-16-30(19-11-5-2-6-12-19)29-22(18)17-9-3-1-4-10-17/h1-16H,(H,27,31)(H,28,32)/b26-15+ |
| InChIKey | UMQZZBCFPIPSSE-CVKSISIWSA-N |
| XLogP | 4.28 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.89 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|