C23H19N5S — CID 6899908
1-[(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]-3-phenylthiourea (PubChem CID 6899908) has the molecular formula C23H19N5S and a molecular weight of 397.51 g/mol. Its IUPAC name is 1-[(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]-3-phenylthiourea.
| Compound Name | 1-[(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]-3-phenylthiourea |
|---|---|
| PubChem CID | 6899908 |
| Molecular Formula | C23H19N5S |
| Molecular Weight | 397.51 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 1-[(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]-3-phenylthiourea |
| SMILES | S=C(N/N=C/c1cn(-c2ccccc2)nc1-c1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C23H19N5S/c29-23(25-20-12-6-2-7-13-20)26-24-16-19-17-28(21-14-8-3-9-15-21)27-22(19)18-10-4-1-5-11-18/h1-17H,(H2,25,26,29)/b24-16+ |
| InChIKey | OKNSMWSMNBWFKD-LFVJCYFKSA-N |
| XLogP | 4.86 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.51 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|