C25H20N4OS — CID 3645403
3-(1,3-diphenylpyrazol-4-yl)-N-(phenylcarbamothioyl)prop-2-enamide (PubChem CID 3645403) has the molecular formula C25H20N4OS and a molecular weight of 424.53 g/mol. Its IUPAC name is 3-(1,3-diphenylpyrazol-4-yl)-N-(phenylcarbamothioyl)prop-2-enamide.
| Compound Name | 3-(1,3-diphenylpyrazol-4-yl)-N-(phenylcarbamothioyl)prop-2-enamide |
|---|---|
| PubChem CID | 3645403 |
| Molecular Formula | C25H20N4OS |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 3-(1,3-diphenylpyrazol-4-yl)-N-(phenylcarbamothioyl)prop-2-enamide |
| SMILES | O=C(C=Cc1cn(-c2ccccc2)nc1-c1ccccc1)NC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C25H20N4OS/c30-23(27-25(31)26-21-12-6-2-7-13-21)17-16-20-18-29(22-14-8-3-9-15-22)28-24(20)19-10-4-1-5-11-19/h1-18H,(H2,26,27,30,31) |
| InChIKey | XKPNBDVTGRTQPD-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|