C24H27N3O — CID 5206073
3-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]-N-pentan-3-ylprop-2-enamide (PubChem CID 5206073) has the molecular formula C24H27N3O and a molecular weight of 373.50 g/mol. Its IUPAC name is 3-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]-N-pentan-3-ylprop-2-enamide.
| Compound Name | 3-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]-N-pentan-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 5206073 |
| Molecular Formula | C24H27N3O |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | 3-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]-N-pentan-3-ylprop-2-enamide |
| SMILES | CCC(CC)NC(=O)C=Cc1cn(-c2ccccc2)nc1-c1ccc(C)cc1 |
| InChI | InChI=1S/C24H27N3O/c1-4-21(5-2)25-23(28)16-15-20-17-27(22-9-7-6-8-10-22)26-24(20)19-13-11-18(3)12-14-19/h6-17,21H,4-5H2,1-3H3,(H,25,28) |
| InChIKey | VMZMGKCVDCBIEV-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|