C26H22FN3O — CID 2558829
(E)-N-(3,5-dimethylphenyl)-3-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]prop-2-enamide (PubChem CID 2558829) has the molecular formula C26H22FN3O and a molecular weight of 411.48 g/mol. Its IUPAC name is (E)-N-(3,5-dimethylphenyl)-3-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]prop-2-enamide.
| Compound Name | (E)-N-(3,5-dimethylphenyl)-3-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 2558829 |
| Molecular Formula | C26H22FN3O |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | (E)-N-(3,5-dimethylphenyl)-3-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]prop-2-enamide |
| SMILES | Cc1cc(C)cc(NC(=O)/C=C/c2cn(-c3ccccc3)nc2-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C26H22FN3O/c1-18-14-19(2)16-23(15-18)28-25(31)13-10-21-17-30(24-6-4-3-5-7-24)29-26(21)20-8-11-22(27)12-9-20/h3-17H,1-2H3,(H,28,31)/b13-10+ |
| InChIKey | PHQNTQCSHGREHN-JLHYYAGUSA-N |
| XLogP | 5.95 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|