C26H23N5O2 — CID 156597868
1-[[(E)-3-(1,3-diphenylpyrazol-4-yl)prop-2-enoyl]amino]-3-(4-methylphenyl)urea (PubChem CID 156597868) has the molecular formula C26H23N5O2 and a molecular weight of 437.50 g/mol. Its IUPAC name is 1-[[(E)-3-(1,3-diphenylpyrazol-4-yl)prop-2-enoyl]amino]-3-(4-methylphenyl)urea.
| Compound Name | 1-[[(E)-3-(1,3-diphenylpyrazol-4-yl)prop-2-enoyl]amino]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 156597868 |
| Molecular Formula | C26H23N5O2 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 1-[[(E)-3-(1,3-diphenylpyrazol-4-yl)prop-2-enoyl]amino]-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)NNC(=O)/C=C/c2cn(-c3ccccc3)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H23N5O2/c1-19-12-15-22(16-13-19)27-26(33)29-28-24(32)17-14-21-18-31(23-10-6-3-7-11-23)30-25(21)20-8-4-2-5-9-20/h2-18H,1H3,(H,28,32)(H2,27,29,33)/b17-14+ |
| InChIKey | DQRRDKXCMZCGKK-SAPNQHFASA-N |
| XLogP | 4.71 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|