C25H21N3O3S — CID 27334682
(E)-3-(1,3-diphenylpyrazol-4-yl)-N-(3-methylsulfonylphenyl)prop-2-enamide (PubChem CID 27334682) has the molecular formula C25H21N3O3S and a molecular weight of 443.53 g/mol. Its IUPAC name is (E)-3-(1,3-diphenylpyrazol-4-yl)-N-(3-methylsulfonylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(1,3-diphenylpyrazol-4-yl)-N-(3-methylsulfonylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 27334682 |
| Molecular Formula | C25H21N3O3S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | (E)-3-(1,3-diphenylpyrazol-4-yl)-N-(3-methylsulfonylphenyl)prop-2-enamide |
| SMILES | CS(=O)(=O)c1cccc(NC(=O)/C=C/c2cn(-c3ccccc3)nc2-c2ccccc2)c1 |
| InChI | InChI=1S/C25H21N3O3S/c1-32(30,31)23-14-8-11-21(17-23)26-24(29)16-15-20-18-28(22-12-6-3-7-13-22)27-25(20)19-9-4-2-5-10-19/h2-18H,1H3,(H,26,29)/b16-15+ |
| InChIKey | GBWJDNGWTZQXMQ-FOCLMDBBSA-N |
| XLogP | 4.59 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|