C25H18N4O — CID 30779165
(E)-N-(3-ethynylphenyl)-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enamide (PubChem CID 30779165) has the molecular formula C25H18N4O and a molecular weight of 390.45 g/mol. Its IUPAC name is (E)-N-(3-ethynylphenyl)-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-(3-ethynylphenyl)-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 30779165 |
| Molecular Formula | C25H18N4O |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | (E)-N-(3-ethynylphenyl)-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enamide |
| SMILES | C#Cc1cccc(NC(=O)/C=C/c2cn(-c3ccccc3)nc2-c2cccnc2)c1 |
| InChI | InChI=1S/C25H18N4O/c1-2-19-8-6-10-22(16-19)27-24(30)14-13-21-18-29(23-11-4-3-5-12-23)28-25(21)20-9-7-15-26-17-20/h1,3-18H,(H,27,30)/b14-13+ |
| InChIKey | NQYAJDATGMKXLU-BUHFOSPRSA-N |
| XLogP | 4.57 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|