C28H23N5O2 — CID 98918748
(E)-N-[2-(3-ethynylanilino)-2-oxoethyl]-N-methyl-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enamide (PubChem CID 98918748) has the molecular formula C28H23N5O2 and a molecular weight of 461.53 g/mol. Its IUPAC name is (E)-N-[2-(3-ethynylanilino)-2-oxoethyl]-N-methyl-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-[2-(3-ethynylanilino)-2-oxoethyl]-N-methyl-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 98918748 |
| Molecular Formula | C28H23N5O2 |
| Molecular Weight | 461.53 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | (E)-N-[2-(3-ethynylanilino)-2-oxoethyl]-N-methyl-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enamide |
| SMILES | C#Cc1cccc(NC(=O)CN(C)C(=O)/C=C/c2cn(-c3ccccc3)nc2-c2cccnc2)c1 |
| InChI | InChI=1S/C28H23N5O2/c1-3-21-9-7-11-24(17-21)30-26(34)20-32(2)27(35)15-14-23-19-33(25-12-5-4-6-13-25)31-28(23)22-10-8-16-29-18-22/h1,4-19H,20H2,2H3,(H,30,34)/b15-14+ |
| InChIKey | BSZKFJKTVFINIK-CCEZHUSRSA-N |
| XLogP | 4.03 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.53 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|