C24H21N5O — CID 9479636
(E)-N'-methyl-N'-phenyl-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enehydrazide (PubChem CID 9479636) has the molecular formula C24H21N5O and a molecular weight of 395.47 g/mol. Its IUPAC name is (E)-N'-methyl-N'-phenyl-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enehydrazide.
| Compound Name | (E)-N'-methyl-N'-phenyl-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 9479636 |
| Molecular Formula | C24H21N5O |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | (E)-N'-methyl-N'-phenyl-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enehydrazide |
| SMILES | CN(NC(=O)/C=C/c1cn(-c2ccccc2)nc1-c1cccnc1)c1ccccc1 |
| InChI | InChI=1S/C24H21N5O/c1-28(21-10-4-2-5-11-21)26-23(30)15-14-20-18-29(22-12-6-3-7-13-22)27-24(20)19-9-8-16-25-17-19/h2-18H,1H3,(H,26,30)/b15-14+ |
| InChIKey | PPQNMXKTSNFVLV-CCEZHUSRSA-N |
| XLogP | 4.12 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|