C23H16F2N4O — CID 9165077
(E)-N-(2,4-difluorophenyl)-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enamide (PubChem CID 9165077) has the molecular formula C23H16F2N4O and a molecular weight of 402.40 g/mol. Its IUPAC name is (E)-N-(2,4-difluorophenyl)-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-(2,4-difluorophenyl)-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 9165077 |
| Molecular Formula | C23H16F2N4O |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | (E)-N-(2,4-difluorophenyl)-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cn(-c2ccccc2)nc1-c1cccnc1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C23H16F2N4O/c24-18-9-10-21(20(25)13-18)27-22(30)11-8-17-15-29(19-6-2-1-3-7-19)28-23(17)16-5-4-12-26-14-16/h1-15H,(H,27,30)/b11-8+ |
| InChIKey | KTMYDLQJLKALAY-DHZHZOJOSA-N |
| XLogP | 4.86 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|