C25H21N5O2S — CID 55388992
(E)-N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enamide (PubChem CID 55388992) has the molecular formula C25H21N5O2S and a molecular weight of 455.54 g/mol. Its IUPAC name is (E)-N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 55388992 |
| Molecular Formula | C25H21N5O2S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | (E)-N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)prop-2-enamide |
| SMILES | NC(=O)CSc1ccccc1NC(=O)/C=C/c1cn(-c2ccccc2)nc1-c1cccnc1 |
| InChI | InChI=1S/C25H21N5O2S/c26-23(31)17-33-22-11-5-4-10-21(22)28-24(32)13-12-19-16-30(20-8-2-1-3-9-20)29-25(19)18-7-6-14-27-15-18/h1-16H,17H2,(H2,26,31)(H,28,32)/b13-12+ |
| InChIKey | YSFYYUIEFUVKRM-OUKQBFOZSA-N |
| XLogP | 4.16 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|