C22H17N5O — CID 26592504
(E)-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)-N-pyridin-3-ylprop-2-enamide (PubChem CID 26592504) has the molecular formula C22H17N5O and a molecular weight of 367.41 g/mol. Its IUPAC name is (E)-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)-N-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)-N-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 26592504 |
| Molecular Formula | C22H17N5O |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | (E)-3-(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)-N-pyridin-3-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1cn(-c2ccccc2)nc1-c1cccnc1)Nc1cccnc1 |
| InChI | InChI=1S/C22H17N5O/c28-21(25-19-7-5-13-24-15-19)11-10-18-16-27(20-8-2-1-3-9-20)26-22(18)17-6-4-12-23-14-17/h1-16H,(H,25,28)/b11-10+ |
| InChIKey | MULDNRWZAAAXJZ-ZHACJKMWSA-N |
| XLogP | 3.98 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|