C26H21FN4O2S — CID 76877643
N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-3-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]prop-2-enamide (PubChem CID 76877643) has the molecular formula C26H21FN4O2S and a molecular weight of 472.55 g/mol. Its IUPAC name is N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-3-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]prop-2-enamide.
| Compound Name | N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-3-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 76877643 |
| Molecular Formula | C26H21FN4O2S |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-3-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]prop-2-enamide |
| SMILES | NC(=O)CSc1ccccc1NC(=O)C=Cc1cn(-c2ccccc2)nc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C26H21FN4O2S/c27-20-13-10-18(11-14-20)26-19(16-31(30-26)21-6-2-1-3-7-21)12-15-25(33)29-22-8-4-5-9-23(22)34-17-24(28)32/h1-16H,17H2,(H2,28,32)(H,29,33) |
| InChIKey | RZHYWQDBGSGXPG-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|