C18H15N3O — CID 2360790
(E)-3-(1,3-diphenylpyrazol-4-yl)prop-2-enamide (PubChem CID 2360790) has the molecular formula C18H15N3O and a molecular weight of 289.34 g/mol. Its IUPAC name is (E)-3-(1,3-diphenylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-3-(1,3-diphenylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 2360790 |
| Molecular Formula | C18H15N3O |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | (E)-3-(1,3-diphenylpyrazol-4-yl)prop-2-enamide |
| SMILES | NC(=O)/C=C/c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C18H15N3O/c19-17(22)12-11-15-13-21(16-9-5-2-6-10-16)20-18(15)14-7-3-1-4-8-14/h1-13H,(H2,19,22)/b12-11+ |
| InChIKey | STSMPNVDWBKBJR-VAWYXSNFSA-N |
| XLogP | 3.04 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|