C18H14N2O — CID 169460172
3-(1,3-diphenylpyrazol-4-yl)prop-2-enal (PubChem CID 169460172) has the molecular formula C18H14N2O and a molecular weight of 274.32 g/mol. Its IUPAC name is 3-(1,3-diphenylpyrazol-4-yl)prop-2-enal.
| Compound Name | 3-(1,3-diphenylpyrazol-4-yl)prop-2-enal |
|---|---|
| PubChem CID | 169460172 |
| Molecular Formula | C18H14N2O |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 3-(1,3-diphenylpyrazol-4-yl)prop-2-enal |
| SMILES | O=CC=Cc1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C18H14N2O/c21-13-7-10-16-14-20(17-11-5-2-6-12-17)19-18(16)15-8-3-1-4-9-15/h1-14H |
| InChIKey | SKFHPZHGGSQRJI-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|