C23H17N3O — CID 8854158
(E)-3-(1,3-diphenylpyrazol-4-yl)-1-pyridin-3-ylprop-2-en-1-one (PubChem CID 8854158) has the molecular formula C23H17N3O and a molecular weight of 351.41 g/mol. Its IUPAC name is (E)-3-(1,3-diphenylpyrazol-4-yl)-1-pyridin-3-ylprop-2-en-1-one.
| Compound Name | (E)-3-(1,3-diphenylpyrazol-4-yl)-1-pyridin-3-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 8854158 |
| Molecular Formula | C23H17N3O |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | (E)-3-(1,3-diphenylpyrazol-4-yl)-1-pyridin-3-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1cn(-c2ccccc2)nc1-c1ccccc1)c1cccnc1 |
| InChI | InChI=1S/C23H17N3O/c27-22(19-10-7-15-24-16-19)14-13-20-17-26(21-11-5-2-6-12-21)25-23(20)18-8-3-1-4-9-18/h1-17H/b14-13+ |
| InChIKey | SNTQXCCHNBTJLR-BUHFOSPRSA-N |
| XLogP | 4.83 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|