C22H18N4O — CID 19543200
(E)-3-(1,3-diphenylpyrazol-4-yl)-1-(1-methylpyrazol-4-yl)prop-2-en-1-one (PubChem CID 19543200) has the molecular formula C22H18N4O and a molecular weight of 354.41 g/mol. Its IUPAC name is (E)-3-(1,3-diphenylpyrazol-4-yl)-1-(1-methylpyrazol-4-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(1,3-diphenylpyrazol-4-yl)-1-(1-methylpyrazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19543200 |
| Molecular Formula | C22H18N4O |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | (E)-3-(1,3-diphenylpyrazol-4-yl)-1-(1-methylpyrazol-4-yl)prop-2-en-1-one |
| SMILES | Cn1cc(C(=O)/C=C/c2cn(-c3ccccc3)nc2-c2ccccc2)cn1 |
| InChI | InChI=1S/C22H18N4O/c1-25-15-19(14-23-25)21(27)13-12-18-16-26(20-10-6-3-7-11-20)24-22(18)17-8-4-2-5-9-17/h2-16H,1H3/b13-12+ |
| InChIKey | ULZPZDOMBLULFG-OUKQBFOZSA-N |
| XLogP | 4.17 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|