C26H22N2O — CID 118734043
(E)-3-[1,3-bis(4-methylphenyl)pyrazol-4-yl]-1-phenylprop-2-en-1-one (PubChem CID 118734043) has the molecular formula C26H22N2O and a molecular weight of 378.48 g/mol. Its IUPAC name is (E)-3-[1,3-bis(4-methylphenyl)pyrazol-4-yl]-1-phenylprop-2-en-1-one.
| Compound Name | (E)-3-[1,3-bis(4-methylphenyl)pyrazol-4-yl]-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 118734043 |
| Molecular Formula | C26H22N2O |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | (E)-3-[1,3-bis(4-methylphenyl)pyrazol-4-yl]-1-phenylprop-2-en-1-one |
| SMILES | Cc1ccc(-c2nn(-c3ccc(C)cc3)cc2/C=C/C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H22N2O/c1-19-8-12-22(13-9-19)26-23(14-17-25(29)21-6-4-3-5-7-21)18-28(27-26)24-15-10-20(2)11-16-24/h3-18H,1-2H3/b17-14+ |
| InChIKey | VRIVLWAORJIVLC-SAPNQHFASA-N |
| XLogP | 6.05 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|