C27H24N2O4S — CID 170987824
(E)-1-(4-methoxyphenyl)-3-[1-(4-methylphenyl)-3-(4-methylsulfonylphenyl)pyrazol-4-yl]prop-2-en-1-one (PubChem CID 170987824) has the molecular formula C27H24N2O4S and a molecular weight of 472.57 g/mol. Its IUPAC name is (E)-1-(4-methoxyphenyl)-3-[1-(4-methylphenyl)-3-(4-methylsulfonylphenyl)pyrazol-4-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-methoxyphenyl)-3-[1-(4-methylphenyl)-3-(4-methylsulfonylphenyl)pyrazol-4-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 170987824 |
| Molecular Formula | C27H24N2O4S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | (E)-1-(4-methoxyphenyl)-3-[1-(4-methylphenyl)-3-(4-methylsulfonylphenyl)pyrazol-4-yl]prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/c2cn(-c3ccc(C)cc3)nc2-c2ccc(S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C27H24N2O4S/c1-19-4-11-23(12-5-19)29-18-22(10-17-26(30)20-6-13-24(33-2)14-7-20)27(28-29)21-8-15-25(16-9-21)34(3,31)32/h4-18H,1-3H3/b17-10+ |
| InChIKey | KYGFMGAMYFUJQJ-LICLKQGHSA-N |
| XLogP | 5.16 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|