C25H17Cl3N2O2 — CID 3917328
3-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]-1-(2,3,4-trichlorophenyl)prop-2-en-1-one (PubChem CID 3917328) has the molecular formula C25H17Cl3N2O2 and a molecular weight of 483.78 g/mol. Its IUPAC name is 3-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]-1-(2,3,4-trichlorophenyl)prop-2-en-1-one.
| Compound Name | 3-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]-1-(2,3,4-trichlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 3917328 |
| Molecular Formula | C25H17Cl3N2O2 |
| Molecular Weight | 483.78 g/mol |
| Exact Mass | 482.04 |
| IUPAC Name | 3-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]-1-(2,3,4-trichlorophenyl)prop-2-en-1-one |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2C=CC(=O)c2ccc(Cl)c(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C25H17Cl3N2O2/c1-32-19-10-7-16(8-11-19)25-17(15-30(29-25)18-5-3-2-4-6-18)9-14-22(31)20-12-13-21(26)24(28)23(20)27/h2-15H,1H3 |
| InChIKey | JRAZCIZUVFYIOD-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.78 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|