C23H25N3O2 — CID 1340732
N,N-diethyl-3-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enamide (PubChem CID 1340732) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is N,N-diethyl-3-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enamide.
| Compound Name | N,N-diethyl-3-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 1340732 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | N,N-diethyl-3-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enamide |
| SMILES | CCN(CC)C(=O)C=Cc1cn(-c2ccccc2)nc1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C23H25N3O2/c1-4-25(5-2)22(27)16-13-19-17-26(20-9-7-6-8-10-20)24-23(19)18-11-14-21(28-3)15-12-18/h6-17H,4-5H2,1-3H3 |
| InChIKey | RDXWNXKRPYIKGZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|