C25H29N3O3 — CID 171141224
N-methoxy-N-methyl-3-[3-[4-(3-methylbutoxy)phenyl]-1-phenylpyrazol-4-yl]prop-2-enamide (PubChem CID 171141224) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is N-methoxy-N-methyl-3-[3-[4-(3-methylbutoxy)phenyl]-1-phenylpyrazol-4-yl]prop-2-enamide.
| Compound Name | N-methoxy-N-methyl-3-[3-[4-(3-methylbutoxy)phenyl]-1-phenylpyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 171141224 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | N-methoxy-N-methyl-3-[3-[4-(3-methylbutoxy)phenyl]-1-phenylpyrazol-4-yl]prop-2-enamide |
| SMILES | CON(C)C(=O)C=Cc1cn(-c2ccccc2)nc1-c1ccc(OCCC(C)C)cc1 |
| InChI | InChI=1S/C25H29N3O3/c1-19(2)16-17-31-23-13-10-20(11-14-23)25-21(12-15-24(29)27(3)30-4)18-28(26-25)22-8-6-5-7-9-22/h5-15,18-19H,16-17H2,1-4H3 |
| InChIKey | QCYZXAXUALZLJA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|