C29H27N3O3S — CID 3565859
2-(benzenesulfonyl)-3-[3-[4-(3-methylbutoxy)phenyl]-1-phenylpyrazol-4-yl]prop-2-enenitrile (PubChem CID 3565859) has the molecular formula C29H27N3O3S and a molecular weight of 497.62 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-3-[3-[4-(3-methylbutoxy)phenyl]-1-phenylpyrazol-4-yl]prop-2-enenitrile.
| Compound Name | 2-(benzenesulfonyl)-3-[3-[4-(3-methylbutoxy)phenyl]-1-phenylpyrazol-4-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 3565859 |
| Molecular Formula | C29H27N3O3S |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | 2-(benzenesulfonyl)-3-[3-[4-(3-methylbutoxy)phenyl]-1-phenylpyrazol-4-yl]prop-2-enenitrile |
| SMILES | CC(C)CCOc1ccc(-c2nn(-c3ccccc3)cc2C=C(C#N)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H27N3O3S/c1-22(2)17-18-35-26-15-13-23(14-16-26)29-24(21-32(31-29)25-9-5-3-6-10-25)19-28(20-30)36(33,34)27-11-7-4-8-12-27/h3-16,19,21-22H,17-18H2,1-2H3 |
| InChIKey | LTKKPLIKIHDJFM-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 84.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|