C31H22FN3O3S — CID 4700105
2-(benzenesulfonyl)-3-[3-[3-[(2-fluorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]prop-2-enenitrile (PubChem CID 4700105) has the molecular formula C31H22FN3O3S and a molecular weight of 535.60 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-3-[3-[3-[(2-fluorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]prop-2-enenitrile.
| Compound Name | 2-(benzenesulfonyl)-3-[3-[3-[(2-fluorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 4700105 |
| Molecular Formula | C31H22FN3O3S |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 535.14 |
| IUPAC Name | 2-(benzenesulfonyl)-3-[3-[3-[(2-fluorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]prop-2-enenitrile |
| SMILES | N#CC(=Cc1cn(-c2ccccc2)nc1-c1cccc(OCc2ccccc2F)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C31H22FN3O3S/c32-30-17-8-7-10-24(30)22-38-27-14-9-11-23(18-27)31-25(21-35(34-31)26-12-3-1-4-13-26)19-29(20-33)39(36,37)28-15-5-2-6-16-28/h1-19,21H,22H2 |
| InChIKey | FDOWGIKVFUCNNZ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 84.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|