C31H21Cl2N3O3S — CID 22529315
(Z)-3-[3-[4-[(2-chlorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]-2-(4-chlorophenyl)sulfonylprop-2-enenitrile (PubChem CID 22529315) has the molecular formula C31H21Cl2N3O3S and a molecular weight of 586.50 g/mol. Its IUPAC name is (Z)-3-[3-[4-[(2-chlorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]-2-(4-chlorophenyl)sulfonylprop-2-enenitrile.
| Compound Name | (Z)-3-[3-[4-[(2-chlorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]-2-(4-chlorophenyl)sulfonylprop-2-enenitrile |
|---|---|
| PubChem CID | 22529315 |
| Molecular Formula | C31H21Cl2N3O3S |
| Molecular Weight | 586.50 g/mol |
| Exact Mass | 585.07 |
| IUPAC Name | (Z)-3-[3-[4-[(2-chlorophenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]-2-(4-chlorophenyl)sulfonylprop-2-enenitrile |
| SMILES | N#C/C(=C/c1cn(-c2ccccc2)nc1-c1ccc(OCc2ccccc2Cl)cc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H21Cl2N3O3S/c32-25-12-16-28(17-13-25)40(37,38)29(19-34)18-24-20-36(26-7-2-1-3-8-26)35-31(24)22-10-14-27(15-11-22)39-21-23-6-4-5-9-30(23)33/h1-18,20H,21H2/b29-18- |
| InChIKey | WGGIZAHJAPHKBS-MIXAMLLLSA-N |
| XLogP | 7.76 |
| TPSA | 84.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.50 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|