C22H16ClNO3S — CID 4994389
2-(benzenesulfonyl)-3-[4-[(2-chlorophenyl)methoxy]phenyl]prop-2-enenitrile (PubChem CID 4994389) has the molecular formula C22H16ClNO3S and a molecular weight of 409.89 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-3-[4-[(2-chlorophenyl)methoxy]phenyl]prop-2-enenitrile.
| Compound Name | 2-(benzenesulfonyl)-3-[4-[(2-chlorophenyl)methoxy]phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 4994389 |
| Molecular Formula | C22H16ClNO3S |
| Molecular Weight | 409.89 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | 2-(benzenesulfonyl)-3-[4-[(2-chlorophenyl)methoxy]phenyl]prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc(OCc2ccccc2Cl)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H16ClNO3S/c23-22-9-5-4-6-18(22)16-27-19-12-10-17(11-13-19)14-21(15-24)28(25,26)20-7-2-1-3-8-20/h1-14H,16H2 |
| InChIKey | AEHWOPKKORPAAD-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.89 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|