C23H16F3NO3S — CID 2209005
(E)-2-(benzenesulfonyl)-3-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]prop-2-enenitrile (PubChem CID 2209005) has the molecular formula C23H16F3NO3S and a molecular weight of 443.45 g/mol. Its IUPAC name is (E)-2-(benzenesulfonyl)-3-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]prop-2-enenitrile.
| Compound Name | (E)-2-(benzenesulfonyl)-3-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 2209005 |
| Molecular Formula | C23H16F3NO3S |
| Molecular Weight | 443.45 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | (E)-2-(benzenesulfonyl)-3-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(OCc2cccc(C(F)(F)F)c2)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H16F3NO3S/c24-23(25,26)19-6-4-5-18(13-19)16-30-20-11-9-17(10-12-20)14-22(15-27)31(28,29)21-7-2-1-3-8-21/h1-14H,16H2/b22-14+ |
| InChIKey | WXSQRCAHQWNEDH-HYARGMPZSA-N |
| XLogP | 5.62 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.45 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|