C15H9F2NO2S — CID 71832957
2-(benzenesulfonyl)-3-(3,4-difluorophenyl)prop-2-enenitrile (PubChem CID 71832957) has the molecular formula C15H9F2NO2S and a molecular weight of 305.31 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-3-(3,4-difluorophenyl)prop-2-enenitrile.
| Compound Name | 2-(benzenesulfonyl)-3-(3,4-difluorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 71832957 |
| Molecular Formula | C15H9F2NO2S |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 2-(benzenesulfonyl)-3-(3,4-difluorophenyl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc(F)c(F)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H9F2NO2S/c16-14-7-6-11(9-15(14)17)8-13(10-18)21(19,20)12-4-2-1-3-5-12/h1-9H |
| InChIKey | RYTZDLJNEKAEIN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|