C15H8ClF2NO2S — CID 35770946
(E)-2-(4-chlorophenyl)sulfonyl-3-(3,4-difluorophenyl)prop-2-enenitrile (PubChem CID 35770946) has the molecular formula C15H8ClF2NO2S and a molecular weight of 339.75 g/mol. Its IUPAC name is (E)-2-(4-chlorophenyl)sulfonyl-3-(3,4-difluorophenyl)prop-2-enenitrile.
| Compound Name | (E)-2-(4-chlorophenyl)sulfonyl-3-(3,4-difluorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 35770946 |
| Molecular Formula | C15H8ClF2NO2S |
| Molecular Weight | 339.75 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | (E)-2-(4-chlorophenyl)sulfonyl-3-(3,4-difluorophenyl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(F)c(F)c1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H8ClF2NO2S/c16-11-2-4-12(5-3-11)22(20,21)13(9-19)7-10-1-6-14(17)15(18)8-10/h1-8H/b13-7+ |
| InChIKey | PVOKMEQFEPDCSG-NTUHNPAUSA-N |
| XLogP | 3.96 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.75 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|