C20H20ClNO3S — CID 4643696
2-(4-chlorophenyl)sulfonyl-3-[4-(3-methylbutoxy)phenyl]prop-2-enenitrile (PubChem CID 4643696) has the molecular formula C20H20ClNO3S and a molecular weight of 389.90 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfonyl-3-[4-(3-methylbutoxy)phenyl]prop-2-enenitrile.
| Compound Name | 2-(4-chlorophenyl)sulfonyl-3-[4-(3-methylbutoxy)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 4643696 |
| Molecular Formula | C20H20ClNO3S |
| Molecular Weight | 389.90 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 2-(4-chlorophenyl)sulfonyl-3-[4-(3-methylbutoxy)phenyl]prop-2-enenitrile |
| SMILES | CC(C)CCOc1ccc(C=C(C#N)S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H20ClNO3S/c1-15(2)11-12-25-18-7-3-16(4-8-18)13-20(14-22)26(23,24)19-9-5-17(21)6-10-19/h3-10,13,15H,11-12H2,1-2H3 |
| InChIKey | YHSRZSWNSLIPDQ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.90 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|