C18H16FNO3S — CID 2677666
(E)-2-(4-fluorophenyl)sulfonyl-3-(4-propoxyphenyl)prop-2-enenitrile (PubChem CID 2677666) has the molecular formula C18H16FNO3S and a molecular weight of 345.40 g/mol. Its IUPAC name is (E)-2-(4-fluorophenyl)sulfonyl-3-(4-propoxyphenyl)prop-2-enenitrile.
| Compound Name | (E)-2-(4-fluorophenyl)sulfonyl-3-(4-propoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 2677666 |
| Molecular Formula | C18H16FNO3S |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | (E)-2-(4-fluorophenyl)sulfonyl-3-(4-propoxyphenyl)prop-2-enenitrile |
| SMILES | CCCOc1ccc(/C=C(\C#N)S(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H16FNO3S/c1-2-11-23-16-7-3-14(4-8-16)12-18(13-20)24(21,22)17-9-5-15(19)6-10-17/h3-10,12H,2,11H2,1H3/b18-12+ |
| InChIKey | SLOSTQXPOUMDMD-LDADJPATSA-N |
| XLogP | 3.95 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|