C18H16FNO4S — CID 2677651
(E)-3-(3-ethoxy-4-methoxyphenyl)-2-(4-fluorophenyl)sulfonylprop-2-enenitrile (PubChem CID 2677651) has the molecular formula C18H16FNO4S and a molecular weight of 361.39 g/mol. Its IUPAC name is (E)-3-(3-ethoxy-4-methoxyphenyl)-2-(4-fluorophenyl)sulfonylprop-2-enenitrile.
| Compound Name | (E)-3-(3-ethoxy-4-methoxyphenyl)-2-(4-fluorophenyl)sulfonylprop-2-enenitrile |
|---|---|
| PubChem CID | 2677651 |
| Molecular Formula | C18H16FNO4S |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | (E)-3-(3-ethoxy-4-methoxyphenyl)-2-(4-fluorophenyl)sulfonylprop-2-enenitrile |
| SMILES | CCOc1cc(/C=C(\C#N)S(=O)(=O)c2ccc(F)cc2)ccc1OC |
| InChI | InChI=1S/C18H16FNO4S/c1-3-24-18-11-13(4-9-17(18)23-2)10-16(12-20)25(21,22)15-7-5-14(19)6-8-15/h4-11H,3H2,1-2H3/b16-10+ |
| InChIKey | SHJJORYVIRPYRM-MHWRWJLKSA-N |
| XLogP | 3.57 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|