C22H25NO4S — CID 4639608
2-(benzenesulfonyl)-3-(3-ethoxy-4-pentoxyphenyl)prop-2-enenitrile (PubChem CID 4639608) has the molecular formula C22H25NO4S and a molecular weight of 399.51 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-3-(3-ethoxy-4-pentoxyphenyl)prop-2-enenitrile.
| Compound Name | 2-(benzenesulfonyl)-3-(3-ethoxy-4-pentoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 4639608 |
| Molecular Formula | C22H25NO4S |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 2-(benzenesulfonyl)-3-(3-ethoxy-4-pentoxyphenyl)prop-2-enenitrile |
| SMILES | CCCCCOc1ccc(C=C(C#N)S(=O)(=O)c2ccccc2)cc1OCC |
| InChI | InChI=1S/C22H25NO4S/c1-3-5-9-14-27-21-13-12-18(16-22(21)26-4-2)15-20(17-23)28(24,25)19-10-7-6-8-11-19/h6-8,10-13,15-16H,3-5,9,14H2,1-2H3 |
| InChIKey | NRJQGQSCMNPVCS-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|