C24H25NO5S — CID 2956786
[4-[2-(benzenesulfonyl)-2-cyanoethenyl]-2-ethoxyphenyl] cyclohexanecarboxylate (PubChem CID 2956786) has the molecular formula C24H25NO5S and a molecular weight of 439.53 g/mol. Its IUPAC name is [4-[2-(benzenesulfonyl)-2-cyanoethenyl]-2-ethoxyphenyl] cyclohexanecarboxylate.
| Compound Name | [4-[2-(benzenesulfonyl)-2-cyanoethenyl]-2-ethoxyphenyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 2956786 |
| Molecular Formula | C24H25NO5S |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | [4-[2-(benzenesulfonyl)-2-cyanoethenyl]-2-ethoxyphenyl] cyclohexanecarboxylate |
| SMILES | CCOc1cc(C=C(C#N)S(=O)(=O)c2ccccc2)ccc1OC(=O)C1CCCCC1 |
| InChI | InChI=1S/C24H25NO5S/c1-2-29-23-16-18(13-14-22(23)30-24(26)19-9-5-3-6-10-19)15-21(17-25)31(27,28)20-11-7-4-8-12-20/h4,7-8,11-16,19H,2-3,5-6,9-10H2,1H3 |
| InChIKey | YLOLXWHFQLREBJ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 93.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|