C19H21NO5 — CID 733849
[4-[(Z)-2-cyano-3-methoxy-3-oxoprop-1-enyl]-2-methoxyphenyl] cyclohexanecarboxylate (PubChem CID 733849) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is [4-[(Z)-2-cyano-3-methoxy-3-oxoprop-1-enyl]-2-methoxyphenyl] cyclohexanecarboxylate.
| Compound Name | [4-[(Z)-2-cyano-3-methoxy-3-oxoprop-1-enyl]-2-methoxyphenyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 733849 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | [4-[(Z)-2-cyano-3-methoxy-3-oxoprop-1-enyl]-2-methoxyphenyl] cyclohexanecarboxylate |
| SMILES | COC(=O)/C(C#N)=C\c1ccc(OC(=O)C2CCCCC2)c(OC)c1 |
| InChI | InChI=1S/C19H21NO5/c1-23-17-11-13(10-15(12-20)18(21)24-2)8-9-16(17)25-19(22)14-6-4-3-5-7-14/h8-11,14H,3-7H2,1-2H3/b15-10- |
| InChIKey | WLFKHCIEYWCATC-GDNBJRDFSA-N |
| XLogP | 3.26 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|