C21H24N2O3 — CID 169383112
[2-methoxy-4-[(phenylhydrazinylidene)methyl]phenyl] cyclohexanecarboxylate (PubChem CID 169383112) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is [2-methoxy-4-[(phenylhydrazinylidene)methyl]phenyl] cyclohexanecarboxylate.
| Compound Name | [2-methoxy-4-[(phenylhydrazinylidene)methyl]phenyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 169383112 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | [2-methoxy-4-[(phenylhydrazinylidene)methyl]phenyl] cyclohexanecarboxylate |
| SMILES | COc1cc(C=NNc2ccccc2)ccc1OC(=O)C1CCCCC1 |
| InChI | InChI=1S/C21H24N2O3/c1-25-20-14-16(15-22-23-18-10-6-3-7-11-18)12-13-19(20)26-21(24)17-8-4-2-5-9-17/h3,6-7,10-15,17,23H,2,4-5,8-9H2,1H3 |
| InChIKey | IRCMLSWLNFBEKS-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|