C25H20N2O3 — CID 20982245
[2-methoxy-4-[(phenylhydrazinylidene)methyl]phenyl] naphthalene-2-carboxylate (PubChem CID 20982245) has the molecular formula C25H20N2O3 and a molecular weight of 396.45 g/mol. Its IUPAC name is [2-methoxy-4-[(phenylhydrazinylidene)methyl]phenyl] naphthalene-2-carboxylate.
| Compound Name | [2-methoxy-4-[(phenylhydrazinylidene)methyl]phenyl] naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 20982245 |
| Molecular Formula | C25H20N2O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | [2-methoxy-4-[(phenylhydrazinylidene)methyl]phenyl] naphthalene-2-carboxylate |
| SMILES | COc1cc(C=NNc2ccccc2)ccc1OC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C25H20N2O3/c1-29-24-15-18(17-26-27-22-9-3-2-4-10-22)11-14-23(24)30-25(28)21-13-12-19-7-5-6-8-20(19)16-21/h2-17,27H,1H3 |
| InChIKey | AWJYNNJRMHXPON-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|