C31H27N7O3 — CID 50870157
[4-[(E)-[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-methoxyphenyl] 4-methylbenzoate (PubChem CID 50870157) has the molecular formula C31H27N7O3 and a molecular weight of 545.60 g/mol. Its IUPAC name is [4-[(E)-[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-methoxyphenyl] 4-methylbenzoate.
| Compound Name | [4-[(E)-[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-methoxyphenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 50870157 |
| Molecular Formula | C31H27N7O3 |
| Molecular Weight | 545.60 g/mol |
| Exact Mass | 545.22 |
| IUPAC Name | [4-[(E)-[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]methyl]-2-methoxyphenyl] 4-methylbenzoate |
| SMILES | COc1cc(/C=N/Nc2nc(Nc3ccccc3)nc(Nc3ccccc3)n2)ccc1OC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C31H27N7O3/c1-21-13-16-23(17-14-21)28(39)41-26-18-15-22(19-27(26)40-2)20-32-38-31-36-29(33-24-9-5-3-6-10-24)35-30(37-31)34-25-11-7-4-8-12-25/h3-20H,1-2H3,(H3,33,34,35,36,37,38)/b32-20+ |
| InChIKey | XWCKKTSUBLHFQM-UZWMFBFFSA-N |
| XLogP | 6.34 |
| TPSA | 122.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.60 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|