C21H17ClN2O3 — CID 110340983
[2-methoxy-4-[(E)-(phenylhydrazinylidene)methyl]phenyl] 4-chlorobenzoate (PubChem CID 110340983) has the molecular formula C21H17ClN2O3 and a molecular weight of 380.83 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-(phenylhydrazinylidene)methyl]phenyl] 4-chlorobenzoate.
| Compound Name | [2-methoxy-4-[(E)-(phenylhydrazinylidene)methyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 110340983 |
| Molecular Formula | C21H17ClN2O3 |
| Molecular Weight | 380.83 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | [2-methoxy-4-[(E)-(phenylhydrazinylidene)methyl]phenyl] 4-chlorobenzoate |
| SMILES | COc1cc(/C=N/Nc2ccccc2)ccc1OC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H17ClN2O3/c1-26-20-13-15(14-23-24-18-5-3-2-4-6-18)7-12-19(20)27-21(25)16-8-10-17(22)11-9-16/h2-14,24H,1H3/b23-14+ |
| InChIKey | RKYATTBSBHVUIA-OEAKJJBVSA-N |
| XLogP | 5.01 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.83 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|